C19H20N6O3S — CID 17048094
2-[[4-amino-5-[(2E)-2-benzylidenehydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-1-(3,4-dimethoxyphenyl)ethanone (PubChem CID 17048094) has the molecular formula C19H20N6O3S and a molecular weight of 412.48 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-benzylidenehydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-1-(3,4-dimethoxyphenyl)ethanone.
| Compound Name | 2-[[4-amino-5-[(2E)-2-benzylidenehydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-1-(3,4-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 17048094 |
| Molecular Formula | C19H20N6O3S |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-benzylidenehydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-1-(3,4-dimethoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)CSc2nnc(N/N=C/c3ccccc3)n2N)cc1OC |
| InChI | InChI=1S/C19H20N6O3S/c1-27-16-9-8-14(10-17(16)28-2)15(26)12-29-19-24-23-18(25(19)20)22-21-11-13-6-4-3-5-7-13/h3-11H,12,20H2,1-2H3,(H,22,23)/b21-11+ |
| InChIKey | IAGODOXHRBWJHE-SRZZPIQSSA-N |
| XLogP | 2.43 |
| TPSA | 116.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|