C22H24N6O3S — CID 17076496
2-[[4-amino-5-[(2E)-2-[(E)-4-phenylbut-3-en-2-ylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-1-(3,4-dimethoxyphenyl)ethanone (PubChem CID 17076496) has the molecular formula C22H24N6O3S and a molecular weight of 452.54 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(E)-4-phenylbut-3-en-2-ylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-1-(3,4-dimethoxyphenyl)ethanone.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(E)-4-phenylbut-3-en-2-ylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-1-(3,4-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 17076496 |
| Molecular Formula | C22H24N6O3S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(E)-4-phenylbut-3-en-2-ylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-1-(3,4-dimethoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)CSc2nnc(N/N=C(C)/C=C/c3ccccc3)n2N)cc1OC |
| InChI | InChI=1S/C22H24N6O3S/c1-15(9-10-16-7-5-4-6-8-16)24-25-21-26-27-22(28(21)23)32-14-18(29)17-11-12-19(30-2)20(13-17)31-3/h4-13H,14,23H2,1-3H3,(H,25,26)/b10-9+,24-15+ |
| InChIKey | OZBWTGOYLUILBV-USFVFONBSA-N |
| XLogP | 3.49 |
| TPSA | 116.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|