C20H20BrN7OS — CID 17076474
2-[[4-amino-5-[(2E)-2-[(E)-4-phenylbut-3-en-2-ylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-bromophenyl)acetamide (PubChem CID 17076474) has the molecular formula C20H20BrN7OS and a molecular weight of 486.40 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(E)-4-phenylbut-3-en-2-ylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-bromophenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(E)-4-phenylbut-3-en-2-ylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-bromophenyl)acetamide |
|---|---|
| PubChem CID | 17076474 |
| Molecular Formula | C20H20BrN7OS |
| Molecular Weight | 486.40 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(E)-4-phenylbut-3-en-2-ylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-bromophenyl)acetamide |
| SMILES | CC(/C=C/c1ccccc1)=N\Nc1nnc(SCC(=O)Nc2cccc(Br)c2)n1N |
| InChI | InChI=1S/C20H20BrN7OS/c1-14(10-11-15-6-3-2-4-7-15)24-25-19-26-27-20(28(19)22)30-13-18(29)23-17-9-5-8-16(21)12-17/h2-12H,13,22H2,1H3,(H,23,29)(H,25,26)/b11-10+,24-14+ |
| InChIKey | UXNXSUSQDUJOJN-PKXMCGRUSA-N |
| XLogP | 3.99 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|