C23H20N6O2S — CID 17048481
2-[[4-amino-5-[(2E)-2-[(3-phenoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-1-phenylethanone (PubChem CID 17048481) has the molecular formula C23H20N6O2S and a molecular weight of 444.52 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(3-phenoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-1-phenylethanone.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(3-phenoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-1-phenylethanone |
|---|---|
| PubChem CID | 17048481 |
| Molecular Formula | C23H20N6O2S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(3-phenoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-1-phenylethanone |
| SMILES | Nn1c(N/N=C/c2cccc(Oc3ccccc3)c2)nnc1SCC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H20N6O2S/c24-29-22(27-28-23(29)32-16-21(30)18-9-3-1-4-10-18)26-25-15-17-8-7-13-20(14-17)31-19-11-5-2-6-12-19/h1-15H,16,24H2,(H,26,27)/b25-15+ |
| InChIKey | VJHGMRCMNNGVJP-MFKUBSTISA-N |
| XLogP | 4.21 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|