C16H15N7OS — CID 17048560
2-[[4-amino-5-[(2E)-2-(pyridin-3-ylmethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-1-phenylethanone (PubChem CID 17048560) has the molecular formula C16H15N7OS and a molecular weight of 353.41 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-(pyridin-3-ylmethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-1-phenylethanone.
| Compound Name | 2-[[4-amino-5-[(2E)-2-(pyridin-3-ylmethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-1-phenylethanone |
|---|---|
| PubChem CID | 17048560 |
| Molecular Formula | C16H15N7OS |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-(pyridin-3-ylmethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-1-phenylethanone |
| SMILES | Nn1c(N/N=C/c2cccnc2)nnc1SCC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H15N7OS/c17-23-15(20-19-10-12-5-4-8-18-9-12)21-22-16(23)25-11-14(24)13-6-2-1-3-7-13/h1-10H,11,17H2,(H,20,21)/b19-10+ |
| InChIKey | ZPQSNLYMRVGOPG-VXLYETTFSA-N |
| XLogP | 1.81 |
| TPSA | 111.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|