C19H17BrN10OS3 — CID 17048602
2-[[4-amino-5-[(2E)-2-(pyridin-3-ylmethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(3-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 17048602) has the molecular formula C19H17BrN10OS3 and a molecular weight of 577.52 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-(pyridin-3-ylmethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(3-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-(pyridin-3-ylmethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(3-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 17048602 |
| Molecular Formula | C19H17BrN10OS3 |
| Molecular Weight | 577.52 g/mol |
| Exact Mass | 575.99 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-(pyridin-3-ylmethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(3-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | Nn1c(N/N=C/c2cccnc2)nnc1SCC(=O)Nc1nnc(SCc2cccc(Br)c2)s1 |
| InChI | InChI=1S/C19H17BrN10OS3/c20-14-5-1-3-12(7-14)10-33-19-29-27-17(34-19)24-15(31)11-32-18-28-26-16(30(18)21)25-23-9-13-4-2-6-22-8-13/h1-9H,10-11,21H2,(H,25,26)(H,24,27,31)/b23-9+ |
| InChIKey | RQDXBGKXQMIRHQ-NUGSKGIGSA-N |
| XLogP | 3.47 |
| TPSA | 148.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|