C25H22BrN9OS3 — CID 17076451
2-[[4-amino-5-[(2E)-2-(1-naphthalen-2-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(3-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 17076451) has the molecular formula C25H22BrN9OS3 and a molecular weight of 640.62 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-(1-naphthalen-2-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(3-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-(1-naphthalen-2-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(3-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 17076451 |
| Molecular Formula | C25H22BrN9OS3 |
| Molecular Weight | 640.62 g/mol |
| Exact Mass | 639.03 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-(1-naphthalen-2-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(3-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | C/C(=N\Nc1nnc(SCC(=O)Nc2nnc(SCc3cccc(Br)c3)s2)n1N)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H22BrN9OS3/c1-15(18-10-9-17-6-2-3-7-19(17)12-18)29-30-22-31-33-24(35(22)27)37-14-21(36)28-23-32-34-25(39-23)38-13-16-5-4-8-20(26)11-16/h2-12H,13-14,27H2,1H3,(H,30,31)(H,28,32,36)/b29-15+ |
| InChIKey | BJCYWENDQVRYJE-WKULSOCRSA-N |
| XLogP | 5.62 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.62 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|