C19H22BrN9OS3 — CID 17077241
2-[[4-amino-5-(2-cyclohexylidenehydrazinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(3-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 17077241) has the molecular formula C19H22BrN9OS3 and a molecular weight of 568.55 g/mol. Its IUPAC name is 2-[[4-amino-5-(2-cyclohexylidenehydrazinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(3-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-[[4-amino-5-(2-cyclohexylidenehydrazinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(3-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 17077241 |
| Molecular Formula | C19H22BrN9OS3 |
| Molecular Weight | 568.55 g/mol |
| Exact Mass | 567.03 |
| IUPAC Name | 2-[[4-amino-5-(2-cyclohexylidenehydrazinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[5-[(3-bromophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | Nn1c(NN=C2CCCCC2)nnc1SCC(=O)Nc1nnc(SCc2cccc(Br)c2)s1 |
| InChI | InChI=1S/C19H22BrN9OS3/c20-13-6-4-5-12(9-13)10-32-19-28-26-17(33-19)22-15(30)11-31-18-27-25-16(29(18)21)24-23-14-7-2-1-3-8-14/h4-6,9H,1-3,7-8,10-11,21H2,(H,24,25)(H,22,26,30) |
| InChIKey | CUAWXPLPUAMJOK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|