C17H23N7OS — CID 17077182
2-[[4-amino-5-(2-cyclohexylidenehydrazinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methylphenyl)acetamide (PubChem CID 17077182) has the molecular formula C17H23N7OS and a molecular weight of 373.49 g/mol. Its IUPAC name is 2-[[4-amino-5-(2-cyclohexylidenehydrazinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[[4-amino-5-(2-cyclohexylidenehydrazinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 17077182 |
| Molecular Formula | C17H23N7OS |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 2-[[4-amino-5-(2-cyclohexylidenehydrazinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)CSc1nnc(NN=C2CCCCC2)n1N |
| InChI | InChI=1S/C17H23N7OS/c1-12-7-5-6-10-14(12)19-15(25)11-26-17-23-22-16(24(17)18)21-20-13-8-3-2-4-9-13/h5-7,10H,2-4,8-9,11,18H2,1H3,(H,19,25)(H,21,22) |
| InChIKey | GVOUNLHCGAWVRZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|