C17H20F3N7OS — CID 17077255
2-[[4-amino-5-(2-cyclohexylidenehydrazinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 17077255) has the molecular formula C17H20F3N7OS and a molecular weight of 427.46 g/mol. Its IUPAC name is 2-[[4-amino-5-(2-cyclohexylidenehydrazinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[[4-amino-5-(2-cyclohexylidenehydrazinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 17077255 |
| Molecular Formula | C17H20F3N7OS |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 2-[[4-amino-5-(2-cyclohexylidenehydrazinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | Nn1c(NN=C2CCCCC2)nnc1SCC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H20F3N7OS/c18-17(19,20)11-5-4-8-13(9-11)22-14(28)10-29-16-26-25-15(27(16)21)24-23-12-6-2-1-3-7-12/h4-5,8-9H,1-3,6-7,10,21H2,(H,22,28)(H,24,25) |
| InChIKey | PIZASEDEUIXTGO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|