C16H19Cl2N7OS — CID 17077227
2-[[4-amino-5-(2-cyclohexylidenehydrazinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3-dichlorophenyl)acetamide (PubChem CID 17077227) has the molecular formula C16H19Cl2N7OS and a molecular weight of 428.35 g/mol. Its IUPAC name is 2-[[4-amino-5-(2-cyclohexylidenehydrazinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3-dichlorophenyl)acetamide.
| Compound Name | 2-[[4-amino-5-(2-cyclohexylidenehydrazinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 17077227 |
| Molecular Formula | C16H19Cl2N7OS |
| Molecular Weight | 428.35 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | 2-[[4-amino-5-(2-cyclohexylidenehydrazinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3-dichlorophenyl)acetamide |
| SMILES | Nn1c(NN=C2CCCCC2)nnc1SCC(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H19Cl2N7OS/c17-11-7-4-8-12(14(11)18)20-13(26)9-27-16-24-23-15(25(16)19)22-21-10-5-2-1-3-6-10/h4,7-8H,1-3,5-6,9,19H2,(H,20,26)(H,22,23) |
| InChIKey | LDFVNKMGPPPDSC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|