C14H17ClN6S — CID 17077283
5-[(2-chlorophenyl)methylsulfanyl]-3-N-(cyclopentylideneamino)-1,2,4-triazole-3,4-diamine (PubChem CID 17077283) has the molecular formula C14H17ClN6S and a molecular weight of 336.85 g/mol. Its IUPAC name is 5-[(2-chlorophenyl)methylsulfanyl]-3-N-(cyclopentylideneamino)-1,2,4-triazole-3,4-diamine.
| Compound Name | 5-[(2-chlorophenyl)methylsulfanyl]-3-N-(cyclopentylideneamino)-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 17077283 |
| Molecular Formula | C14H17ClN6S |
| Molecular Weight | 336.85 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 5-[(2-chlorophenyl)methylsulfanyl]-3-N-(cyclopentylideneamino)-1,2,4-triazole-3,4-diamine |
| SMILES | Nn1c(NN=C2CCCC2)nnc1SCc1ccccc1Cl |
| InChI | InChI=1S/C14H17ClN6S/c15-12-8-4-1-5-10(12)9-22-14-20-19-13(21(14)16)18-17-11-6-2-3-7-11/h1,4-5,8H,2-3,6-7,9,16H2,(H,18,19) |
| InChIKey | UQLQSTCUZHBFLJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.85 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|