C15H19ClN6S — CID 17077204
5-[(2-chlorophenyl)methylsulfanyl]-3-N-(cyclohexylideneamino)-1,2,4-triazole-3,4-diamine (PubChem CID 17077204) has the molecular formula C15H19ClN6S and a molecular weight of 350.88 g/mol. Its IUPAC name is 5-[(2-chlorophenyl)methylsulfanyl]-3-N-(cyclohexylideneamino)-1,2,4-triazole-3,4-diamine.
| Compound Name | 5-[(2-chlorophenyl)methylsulfanyl]-3-N-(cyclohexylideneamino)-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 17077204 |
| Molecular Formula | C15H19ClN6S |
| Molecular Weight | 350.88 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 5-[(2-chlorophenyl)methylsulfanyl]-3-N-(cyclohexylideneamino)-1,2,4-triazole-3,4-diamine |
| SMILES | Nn1c(NN=C2CCCCC2)nnc1SCc1ccccc1Cl |
| InChI | InChI=1S/C15H19ClN6S/c16-13-9-5-4-6-11(13)10-23-15-21-20-14(22(15)17)19-18-12-7-2-1-3-8-12/h4-6,9H,1-3,7-8,10,17H2,(H,19,20) |
| InChIKey | AFRIQZLTNILPOW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.88 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|