C16H22N6S — CID 17077214
3-N-(cyclohexylideneamino)-5-[(4-methylphenyl)methylsulfanyl]-1,2,4-triazole-3,4-diamine (PubChem CID 17077214) has the molecular formula C16H22N6S and a molecular weight of 330.46 g/mol. Its IUPAC name is 3-N-(cyclohexylideneamino)-5-[(4-methylphenyl)methylsulfanyl]-1,2,4-triazole-3,4-diamine.
| Compound Name | 3-N-(cyclohexylideneamino)-5-[(4-methylphenyl)methylsulfanyl]-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 17077214 |
| Molecular Formula | C16H22N6S |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 3-N-(cyclohexylideneamino)-5-[(4-methylphenyl)methylsulfanyl]-1,2,4-triazole-3,4-diamine |
| SMILES | Cc1ccc(CSc2nnc(NN=C3CCCCC3)n2N)cc1 |
| InChI | InChI=1S/C16H22N6S/c1-12-7-9-13(10-8-12)11-23-16-21-20-15(22(16)17)19-18-14-5-3-2-4-6-14/h7-10H,2-6,11,17H2,1H3,(H,19,20) |
| InChIKey | YKXKPGCYELPSAK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|