C15H17Cl2N7OS — CID 17077271
2-[[4-amino-5-(2-cyclopentylidenehydrazinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,5-dichlorophenyl)acetamide (PubChem CID 17077271) has the molecular formula C15H17Cl2N7OS and a molecular weight of 414.32 g/mol. Its IUPAC name is 2-[[4-amino-5-(2-cyclopentylidenehydrazinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,5-dichlorophenyl)acetamide.
| Compound Name | 2-[[4-amino-5-(2-cyclopentylidenehydrazinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,5-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 17077271 |
| Molecular Formula | C15H17Cl2N7OS |
| Molecular Weight | 414.32 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 2-[[4-amino-5-(2-cyclopentylidenehydrazinyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,5-dichlorophenyl)acetamide |
| SMILES | Nn1c(NN=C2CCCC2)nnc1SCC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H17Cl2N7OS/c16-9-5-6-11(17)12(7-9)19-13(25)8-26-15-23-22-14(24(15)18)21-20-10-3-1-2-4-10/h5-7H,1-4,8,18H2,(H,19,25)(H,21,22) |
| InChIKey | KQPVORDQJXCJTO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|