C11H14ClN7OS — CID 17344905
2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]-N-(5-chloro-2-methylphenyl)acetamide (PubChem CID 17344905) has the molecular formula C11H14ClN7OS and a molecular weight of 327.80 g/mol. Its IUPAC name is 2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]-N-(5-chloro-2-methylphenyl)acetamide.
| Compound Name | 2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]-N-(5-chloro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 17344905 |
| Molecular Formula | C11H14ClN7OS |
| Molecular Weight | 327.80 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]-N-(5-chloro-2-methylphenyl)acetamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)CSc1nnc(NN)n1N |
| InChI | InChI=1S/C11H14ClN7OS/c1-6-2-3-7(12)4-8(6)15-9(20)5-21-11-18-17-10(16-13)19(11)14/h2-4H,5,13-14H2,1H3,(H,15,20)(H,16,17) |
| InChIKey | FGQAZRVATVWKHE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 123.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.80 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|