C19H20ClN7O2S — CID 17048767
2-[[4-amino-5-[(2E)-2-[(4-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(5-chloro-2-methylphenyl)acetamide (PubChem CID 17048767) has the molecular formula C19H20ClN7O2S and a molecular weight of 445.94 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(4-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(5-chloro-2-methylphenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(4-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(5-chloro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 17048767 |
| Molecular Formula | C19H20ClN7O2S |
| Molecular Weight | 445.94 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(4-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(5-chloro-2-methylphenyl)acetamide |
| SMILES | COc1ccc(/C=N/Nc2nnc(SCC(=O)Nc3cc(Cl)ccc3C)n2N)cc1 |
| InChI | InChI=1S/C19H20ClN7O2S/c1-12-3-6-14(20)9-16(12)23-17(28)11-30-19-26-25-18(27(19)21)24-22-10-13-4-7-15(29-2)8-5-13/h3-10H,11,21H2,1-2H3,(H,23,28)(H,24,25)/b22-10+ |
| InChIKey | BJRHZDVGHRXSOJ-LSHDLFTRSA-N |
| XLogP | 3.14 |
| TPSA | 119.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.94 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|