C20H20ClN7OS — CID 17074960
2-[[4-amino-5-[(2E)-2-[(E)-3-phenylprop-2-enylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(5-chloro-2-methylphenyl)acetamide (PubChem CID 17074960) has the molecular formula C20H20ClN7OS and a molecular weight of 441.95 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(E)-3-phenylprop-2-enylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(5-chloro-2-methylphenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(E)-3-phenylprop-2-enylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(5-chloro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 17074960 |
| Molecular Formula | C20H20ClN7OS |
| Molecular Weight | 441.95 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(E)-3-phenylprop-2-enylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(5-chloro-2-methylphenyl)acetamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)CSc1nnc(N/N=C/C=C/c2ccccc2)n1N |
| InChI | InChI=1S/C20H20ClN7OS/c1-14-9-10-16(21)12-17(14)24-18(29)13-30-20-27-26-19(28(20)22)25-23-11-5-8-15-6-3-2-4-7-15/h2-12H,13,22H2,1H3,(H,24,29)(H,25,26)/b8-5+,23-11+ |
| InChIKey | ASGVFGXOOPVZIK-VBNIKMFGSA-N |
| XLogP | 3.80 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.95 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|