C17H14BrCl2N7OS — CID 17048316
2-[[4-amino-5-[(2E)-2-[(3-bromophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2,5-dichlorophenyl)acetamide (PubChem CID 17048316) has the molecular formula C17H14BrCl2N7OS and a molecular weight of 515.22 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(3-bromophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2,5-dichlorophenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(3-bromophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2,5-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 17048316 |
| Molecular Formula | C17H14BrCl2N7OS |
| Molecular Weight | 515.22 g/mol |
| Exact Mass | 512.95 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(3-bromophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2,5-dichlorophenyl)acetamide |
| SMILES | Nn1c(N/N=C/c2cccc(Br)c2)nnc1SCC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H14BrCl2N7OS/c18-11-3-1-2-10(6-11)8-22-24-16-25-26-17(27(16)21)29-9-15(28)23-14-7-12(19)4-5-13(14)20/h1-8H,9,21H2,(H,23,28)(H,24,25)/b22-8+ |
| InChIKey | NFHMGKZPDIDGKE-GZIVZEMBSA-N |
| XLogP | 4.24 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.22 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|