C18H16BrCl2N7O2S — CID 17075727
2-[[4-amino-5-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3-dichlorophenyl)acetamide (PubChem CID 17075727) has the molecular formula C18H16BrCl2N7O2S and a molecular weight of 545.25 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3-dichlorophenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 17075727 |
| Molecular Formula | C18H16BrCl2N7O2S |
| Molecular Weight | 545.25 g/mol |
| Exact Mass | 542.96 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3-dichlorophenyl)acetamide |
| SMILES | COc1ccc(Br)cc1/C=N/Nc1nnc(SCC(=O)Nc2cccc(Cl)c2Cl)n1N |
| InChI | InChI=1S/C18H16BrCl2N7O2S/c1-30-14-6-5-11(19)7-10(14)8-23-25-17-26-27-18(28(17)22)31-9-15(29)24-13-4-2-3-12(20)16(13)21/h2-8H,9,22H2,1H3,(H,24,29)(H,25,26)/b23-8+ |
| InChIKey | YDLBAZRIOIJNIE-LIMNOBDPSA-N |
| XLogP | 4.25 |
| TPSA | 119.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.25 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|