C25H24ClN7O3S — CID 17075809
2-[[4-amino-5-[(2E)-2-[(2-phenylmethoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(5-chloro-2-methoxyphenyl)acetamide (PubChem CID 17075809) has the molecular formula C25H24ClN7O3S and a molecular weight of 538.03 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(2-phenylmethoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(5-chloro-2-methoxyphenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(2-phenylmethoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(5-chloro-2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 17075809 |
| Molecular Formula | C25H24ClN7O3S |
| Molecular Weight | 538.03 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(2-phenylmethoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(5-chloro-2-methoxyphenyl)acetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CSc1nnc(N/N=C/c2ccccc2OCc2ccccc2)n1N |
| InChI | InChI=1S/C25H24ClN7O3S/c1-35-22-12-11-19(26)13-20(22)29-23(34)16-37-25-32-31-24(33(25)27)30-28-14-18-9-5-6-10-21(18)36-15-17-7-3-2-4-8-17/h2-14H,15-16,27H2,1H3,(H,29,34)(H,30,31)/b28-14+ |
| InChIKey | MSUJODADWYDHAX-CCVNUDIWSA-N |
| XLogP | 4.41 |
| TPSA | 128.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.03 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|