C23H22N6OS — CID 17075781
5-benzylsulfanyl-3-N-[(E)-(2-phenylmethoxyphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine (PubChem CID 17075781) has the molecular formula C23H22N6OS and a molecular weight of 430.54 g/mol. Its IUPAC name is 5-benzylsulfanyl-3-N-[(E)-(2-phenylmethoxyphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine.
| Compound Name | 5-benzylsulfanyl-3-N-[(E)-(2-phenylmethoxyphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 17075781 |
| Molecular Formula | C23H22N6OS |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 5-benzylsulfanyl-3-N-[(E)-(2-phenylmethoxyphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine |
| SMILES | Nn1c(N/N=C/c2ccccc2OCc2ccccc2)nnc1SCc1ccccc1 |
| InChI | InChI=1S/C23H22N6OS/c24-29-22(27-28-23(29)31-17-19-11-5-2-6-12-19)26-25-15-20-13-7-8-14-21(20)30-16-18-9-3-1-4-10-18/h1-15H,16-17,24H2,(H,26,27)/b25-15+ |
| InChIKey | VDHBSFOETLEQLG-MFKUBSTISA-N |
| XLogP | 4.31 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|