C23H21FN6OS — CID 17075794
5-[(4-fluorophenyl)methylsulfanyl]-3-N-[(E)-(2-phenylmethoxyphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine (PubChem CID 17075794) has the molecular formula C23H21FN6OS and a molecular weight of 448.53 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methylsulfanyl]-3-N-[(E)-(2-phenylmethoxyphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine.
| Compound Name | 5-[(4-fluorophenyl)methylsulfanyl]-3-N-[(E)-(2-phenylmethoxyphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 17075794 |
| Molecular Formula | C23H21FN6OS |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 5-[(4-fluorophenyl)methylsulfanyl]-3-N-[(E)-(2-phenylmethoxyphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine |
| SMILES | Nn1c(N/N=C/c2ccccc2OCc2ccccc2)nnc1SCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H21FN6OS/c24-20-12-10-18(11-13-20)16-32-23-29-28-22(30(23)25)27-26-14-19-8-4-5-9-21(19)31-15-17-6-2-1-3-7-17/h1-14H,15-16,25H2,(H,27,28)/b26-14+ |
| InChIKey | FONOMZGFGSGDKZ-VULFUBBASA-N |
| XLogP | 4.45 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|