C24H22BrN7O2S — CID 17075765
2-[[4-amino-5-[(2E)-2-[(2-phenylmethoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-bromophenyl)acetamide (PubChem CID 17075765) has the molecular formula C24H22BrN7O2S and a molecular weight of 552.46 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(2-phenylmethoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-bromophenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(2-phenylmethoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-bromophenyl)acetamide |
|---|---|
| PubChem CID | 17075765 |
| Molecular Formula | C24H22BrN7O2S |
| Molecular Weight | 552.46 g/mol |
| Exact Mass | 551.07 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(2-phenylmethoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-bromophenyl)acetamide |
| SMILES | Nn1c(N/N=C/c2ccccc2OCc2ccccc2)nnc1SCC(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C24H22BrN7O2S/c25-19-11-5-6-12-20(19)28-22(33)16-35-24-31-30-23(32(24)26)29-27-14-18-10-4-7-13-21(18)34-15-17-8-2-1-3-9-17/h1-14H,15-16,26H2,(H,28,33)(H,29,30)/b27-14+ |
| InChIKey | JPCRUWZIGOTRHA-MZJWZYIUSA-N |
| XLogP | 4.51 |
| TPSA | 119.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|