C25H24ClN7O2S — CID 17077339
2-[[4-amino-5-[(2E)-2-[[2-[(4-chlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methylphenyl)acetamide (PubChem CID 17077339) has the molecular formula C25H24ClN7O2S and a molecular weight of 522.03 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[[2-[(4-chlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[[2-[(4-chlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 17077339 |
| Molecular Formula | C25H24ClN7O2S |
| Molecular Weight | 522.03 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[[2-[(4-chlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CSc2nnc(N/N=C/c3ccccc3OCc3ccc(Cl)cc3)n2N)c1 |
| InChI | InChI=1S/C25H24ClN7O2S/c1-17-5-4-7-21(13-17)29-23(34)16-36-25-32-31-24(33(25)27)30-28-14-19-6-2-3-8-22(19)35-15-18-9-11-20(26)12-10-18/h2-14H,15-16,27H2,1H3,(H,29,34)(H,30,31)/b28-14+ |
| InChIKey | XHTUTTXEYUFKRA-CCVNUDIWSA-N |
| XLogP | 4.71 |
| TPSA | 119.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.03 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|