C23H19Cl3N6OS — CID 17076815
3-N-[(E)-[2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-5-[(3,4-dichlorophenyl)methylsulfanyl]-1,2,4-triazole-3,4-diamine (PubChem CID 17076815) has the molecular formula C23H19Cl3N6OS and a molecular weight of 533.87 g/mol. Its IUPAC name is 3-N-[(E)-[2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-5-[(3,4-dichlorophenyl)methylsulfanyl]-1,2,4-triazole-3,4-diamine.
| Compound Name | 3-N-[(E)-[2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-5-[(3,4-dichlorophenyl)methylsulfanyl]-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 17076815 |
| Molecular Formula | C23H19Cl3N6OS |
| Molecular Weight | 533.87 g/mol |
| Exact Mass | 532.04 |
| IUPAC Name | 3-N-[(E)-[2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-5-[(3,4-dichlorophenyl)methylsulfanyl]-1,2,4-triazole-3,4-diamine |
| SMILES | Nn1c(N/N=C/c2ccccc2OCc2ccccc2Cl)nnc1SCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H19Cl3N6OS/c24-18-7-3-1-6-17(18)13-33-21-8-4-2-5-16(21)12-28-29-22-30-31-23(32(22)27)34-14-15-9-10-19(25)20(26)11-15/h1-12H,13-14,27H2,(H,29,30)/b28-12+ |
| InChIKey | KEBGPAQQEYFNPQ-KVSWJAHQSA-N |
| XLogP | 6.27 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.87 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|