C27H25ClN8O2S2 — CID 17076851
2-[[4-amino-5-[(2E)-2-[[2-[(2-chlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide (PubChem CID 17076851) has the molecular formula C27H25ClN8O2S2 and a molecular weight of 593.14 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[[2-[(2-chlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[[2-[(2-chlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 17076851 |
| Molecular Formula | C27H25ClN8O2S2 |
| Molecular Weight | 593.14 g/mol |
| Exact Mass | 592.12 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[[2-[(2-chlorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
| SMILES | N#Cc1c(NC(=O)CSc2nnc(N/N=C/c3ccccc3OCc3ccccc3Cl)n2N)sc2c1CCCC2 |
| InChI | InChI=1S/C27H25ClN8O2S2/c28-21-10-4-1-8-18(21)15-38-22-11-5-2-7-17(22)14-31-33-26-34-35-27(36(26)30)39-16-24(37)32-25-20(13-29)19-9-3-6-12-23(19)40-25/h1-2,4-5,7-8,10-11,14H,3,6,9,12,15-16,30H2,(H,32,37)(H,33,34)/b31-14+ |
| InChIKey | JEUNAMLLSNEWSV-XAZZYMPDSA-N |
| XLogP | 5.21 |
| TPSA | 143.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.14 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|