C20H18Cl2N8OS2 — CID 17049553
2-[[4-amino-5-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide (PubChem CID 17049553) has the molecular formula C20H18Cl2N8OS2 and a molecular weight of 521.46 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 17049553 |
| Molecular Formula | C20H18Cl2N8OS2 |
| Molecular Weight | 521.46 g/mol |
| Exact Mass | 520.04 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
| SMILES | N#Cc1c(NC(=O)CSc2nnc(N/N=C/c3ccc(Cl)cc3Cl)n2N)sc2c1CCCC2 |
| InChI | InChI=1S/C20H18Cl2N8OS2/c21-12-6-5-11(15(22)7-12)9-25-27-19-28-29-20(30(19)24)32-10-17(31)26-18-14(8-23)13-3-1-2-4-16(13)33-18/h5-7,9H,1-4,10,24H2,(H,26,31)(H,27,28)/b25-9+ |
| InChIKey | JZXZJBPOSXEOTL-YCPBAFNGSA-N |
| XLogP | 4.29 |
| TPSA | 134.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|