C19H18Cl2N6O2S2 — CID 24576812
2-[[2-[[4-amino-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 24576812) has the molecular formula C19H18Cl2N6O2S2 and a molecular weight of 497.43 g/mol. Its IUPAC name is 2-[[2-[[4-amino-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-[[4-amino-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 24576812 |
| Molecular Formula | C19H18Cl2N6O2S2 |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 496.03 |
| IUPAC Name | 2-[[2-[[4-amino-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)CSc2nnc(-c3ccc(Cl)cc3Cl)n2N)sc2c1CCCC2 |
| InChI | InChI=1S/C19H18Cl2N6O2S2/c20-9-5-6-10(12(21)7-9)17-25-26-19(27(17)23)30-8-14(28)24-18-15(16(22)29)11-3-1-2-4-13(11)31-18/h5-7H,1-4,8,23H2,(H2,22,29)(H,24,28) |
| InChIKey | UFDDRRAGXMOAOB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |