C16H10Cl5N5OS — CID 5025979
2-[[4-amino-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 5025979) has the molecular formula C16H10Cl5N5OS and a molecular weight of 497.62 g/mol. Its IUPAC name is 2-[[4-amino-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[[4-amino-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 5025979 |
| Molecular Formula | C16H10Cl5N5OS |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 494.90 |
| IUPAC Name | 2-[[4-amino-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | Nn1c(SCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)nnc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H10Cl5N5OS/c17-7-1-2-8(9(18)3-7)15-24-25-16(26(15)22)28-6-14(27)23-13-5-11(20)10(19)4-12(13)21/h1-5H,6,22H2,(H,23,27) |
| InChIKey | PMUMALYWTMJBMD-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|