C19H19Cl2N5OS — CID 3996832
2-[[4-amino-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-phenylpropyl)acetamide (PubChem CID 3996832) has the molecular formula C19H19Cl2N5OS and a molecular weight of 436.37 g/mol. Its IUPAC name is 2-[[4-amino-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[[4-amino-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 3996832 |
| Molecular Formula | C19H19Cl2N5OS |
| Molecular Weight | 436.37 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | 2-[[4-amino-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-phenylpropyl)acetamide |
| SMILES | Nn1c(SCC(=O)NCCCc2ccccc2)nnc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H19Cl2N5OS/c20-14-8-9-15(16(21)11-14)18-24-25-19(26(18)22)28-12-17(27)23-10-4-7-13-5-2-1-3-6-13/h1-3,5-6,8-9,11H,4,7,10,12,22H2,(H,23,27) |
| InChIKey | KDNIKGVHOPCTTJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|