C18H17Cl2N5O2S — CID 18291427
2-[[4-amino-5-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-phenoxyethyl)acetamide (PubChem CID 18291427) has the molecular formula C18H17Cl2N5O2S and a molecular weight of 438.34 g/mol. Its IUPAC name is 2-[[4-amino-5-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-phenoxyethyl)acetamide.
| Compound Name | 2-[[4-amino-5-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-phenoxyethyl)acetamide |
|---|---|
| PubChem CID | 18291427 |
| Molecular Formula | C18H17Cl2N5O2S |
| Molecular Weight | 438.34 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | 2-[[4-amino-5-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-phenoxyethyl)acetamide |
| SMILES | Nn1c(SCC(=O)NCCOc2ccccc2)nnc1-c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H17Cl2N5O2S/c19-12-6-7-15(20)14(10-12)17-23-24-18(25(17)21)28-11-16(26)22-8-9-27-13-4-2-1-3-5-13/h1-7,10H,8-9,11,21H2,(H,22,26) |
| InChIKey | MYBUCNJXOJGJJL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|