C14H14Cl2N6O2S — CID 7915682
2-[[4-amino-5-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide (PubChem CID 7915682) has the molecular formula C14H14Cl2N6O2S and a molecular weight of 401.28 g/mol. Its IUPAC name is 2-[[4-amino-5-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide.
| Compound Name | 2-[[4-amino-5-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 7915682 |
| Molecular Formula | C14H14Cl2N6O2S |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 2-[[4-amino-5-(2,5-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide |
| SMILES | C=CCNC(=O)NC(=O)CSc1nnc(-c2cc(Cl)ccc2Cl)n1N |
| InChI | InChI=1S/C14H14Cl2N6O2S/c1-2-5-18-13(24)19-11(23)7-25-14-21-20-12(22(14)17)9-6-8(15)3-4-10(9)16/h2-4,6H,1,5,7,17H2,(H2,18,19,23,24) |
| InChIKey | QIVZWNAMNGPMKK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|