C20H17ClFN5O2S — CID 40811588
2-[[5-(2-chlorophenyl)-4-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide (PubChem CID 40811588) has the molecular formula C20H17ClFN5O2S and a molecular weight of 445.91 g/mol. Its IUPAC name is 2-[[5-(2-chlorophenyl)-4-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide.
| Compound Name | 2-[[5-(2-chlorophenyl)-4-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 40811588 |
| Molecular Formula | C20H17ClFN5O2S |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 2-[[5-(2-chlorophenyl)-4-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(prop-2-enylcarbamoyl)acetamide |
| SMILES | C=CCNC(=O)NC(=O)CSc1nnc(-c2ccccc2Cl)n1-c1ccccc1F |
| InChI | InChI=1S/C20H17ClFN5O2S/c1-2-11-23-19(29)24-17(28)12-30-20-26-25-18(13-7-3-4-8-14(13)21)27(20)16-10-6-5-9-15(16)22/h2-10H,1,11-12H2,(H2,23,24,28,29) |
| InChIKey | BWRJADVLTQIBIW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|