C16H18FN5O2S — CID 112784522
N-(ethylcarbamoyl)-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 112784522) has the molecular formula C16H18FN5O2S and a molecular weight of 363.42 g/mol. Its IUPAC name is N-(ethylcarbamoyl)-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(ethylcarbamoyl)-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 112784522 |
| Molecular Formula | C16H18FN5O2S |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N-(ethylcarbamoyl)-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)NC(=O)NCC)nnc1-c1ccccc1F |
| InChI | InChI=1S/C16H18FN5O2S/c1-3-9-22-14(11-7-5-6-8-12(11)17)20-21-16(22)25-10-13(23)19-15(24)18-4-2/h3,5-8H,1,4,9-10H2,2H3,(H2,18,19,23,24) |
| InChIKey | YDWZGQMFDBPOBL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|