C21H26FN5O2S — CID 112784678
2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-methylcyclohexyl)carbamoyl]acetamide (PubChem CID 112784678) has the molecular formula C21H26FN5O2S and a molecular weight of 431.54 g/mol. Its IUPAC name is 2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-methylcyclohexyl)carbamoyl]acetamide.
| Compound Name | 2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-methylcyclohexyl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 112784678 |
| Molecular Formula | C21H26FN5O2S |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-methylcyclohexyl)carbamoyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)NC(=O)NC2CCCCC2C)nnc1-c1ccccc1F |
| InChI | InChI=1S/C21H26FN5O2S/c1-3-12-27-19(15-9-5-6-10-16(15)22)25-26-21(27)30-13-18(28)24-20(29)23-17-11-7-4-8-14(17)2/h3,5-6,9-10,14,17H,1,4,7-8,11-13H2,2H3,(H2,23,24,28,29) |
| InChIKey | HQJRCLNVFUIFSS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|