C20H20ClFN4O2S — CID 42966255
2-[[5-(2-chlorophenyl)-4-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropyl)acetamide (PubChem CID 42966255) has the molecular formula C20H20ClFN4O2S and a molecular weight of 434.92 g/mol. Its IUPAC name is 2-[[5-(2-chlorophenyl)-4-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[[5-(2-chlorophenyl)-4-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 42966255 |
| Molecular Formula | C20H20ClFN4O2S |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 2-[[5-(2-chlorophenyl)-4-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CSc1nnc(-c2ccccc2Cl)n1-c1ccccc1F |
| InChI | InChI=1S/C20H20ClFN4O2S/c1-28-12-6-11-23-18(27)13-29-20-25-24-19(14-7-2-3-8-15(14)21)26(20)17-10-5-4-9-16(17)22/h2-5,7-10H,6,11-13H2,1H3,(H,23,27) |
| InChIKey | HQGVHNAHBVSZTE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|