C20H20Cl2N4O2S — CID 41232336
2-[[5-(2,4-dichlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropyl)acetamide (PubChem CID 41232336) has the molecular formula C20H20Cl2N4O2S and a molecular weight of 451.38 g/mol. Its IUPAC name is 2-[[5-(2,4-dichlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[[5-(2,4-dichlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 41232336 |
| Molecular Formula | C20H20Cl2N4O2S |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 2-[[5-(2,4-dichlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CSc1nnc(-c2ccc(Cl)cc2Cl)n1-c1ccccc1 |
| InChI | InChI=1S/C20H20Cl2N4O2S/c1-28-11-5-10-23-18(27)13-29-20-25-24-19(16-9-8-14(21)12-17(16)22)26(20)15-6-3-2-4-7-15/h2-4,6-9,12H,5,10-11,13H2,1H3,(H,23,27) |
| InChIKey | CEOROADJVYWXIJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|