C15H18ClN5O3S — CID 41224732
2-[[5-(2-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethylcarbamoyl)acetamide (PubChem CID 41224732) has the molecular formula C15H18ClN5O3S and a molecular weight of 383.86 g/mol. Its IUPAC name is 2-[[5-(2-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethylcarbamoyl)acetamide.
| Compound Name | 2-[[5-(2-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 41224732 |
| Molecular Formula | C15H18ClN5O3S |
| Molecular Weight | 383.86 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 2-[[5-(2-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethylcarbamoyl)acetamide |
| SMILES | COCCNC(=O)NC(=O)CSc1nnc(-c2ccccc2Cl)n1C |
| InChI | InChI=1S/C15H18ClN5O3S/c1-21-13(10-5-3-4-6-11(10)16)19-20-15(21)25-9-12(22)18-14(23)17-7-8-24-2/h3-6H,7-9H2,1-2H3,(H2,17,18,22,23) |
| InChIKey | LQIYRMCFTVJIRO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.86 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|