C14H14ClN5OS — CID 7690317
2-[[5-(2-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-cyanoethyl)acetamide (PubChem CID 7690317) has the molecular formula C14H14ClN5OS and a molecular weight of 335.82 g/mol. Its IUPAC name is 2-[[5-(2-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-cyanoethyl)acetamide.
| Compound Name | 2-[[5-(2-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-cyanoethyl)acetamide |
|---|---|
| PubChem CID | 7690317 |
| Molecular Formula | C14H14ClN5OS |
| Molecular Weight | 335.82 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 2-[[5-(2-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-cyanoethyl)acetamide |
| SMILES | Cn1c(SCC(=O)NCCC#N)nnc1-c1ccccc1Cl |
| InChI | InChI=1S/C14H14ClN5OS/c1-20-13(10-5-2-3-6-11(10)15)18-19-14(20)22-9-12(21)17-8-4-7-16/h2-3,5-6H,4,8-9H2,1H3,(H,17,21) |
| InChIKey | BPOCCMVVQHNTRY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.82 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|