C20H25N5O3S — CID 8581544
2-[[4-amino-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(4-tert-butylphenoxy)ethyl]acetamide (PubChem CID 8581544) has the molecular formula C20H25N5O3S and a molecular weight of 415.52 g/mol. Its IUPAC name is 2-[[4-amino-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(4-tert-butylphenoxy)ethyl]acetamide.
| Compound Name | 2-[[4-amino-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(4-tert-butylphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 8581544 |
| Molecular Formula | C20H25N5O3S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 2-[[4-amino-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(4-tert-butylphenoxy)ethyl]acetamide |
| SMILES | CC(C)(C)c1ccc(OCCNC(=O)CSc2nnc(-c3ccco3)n2N)cc1 |
| InChI | InChI=1S/C20H25N5O3S/c1-20(2,3)14-6-8-15(9-7-14)27-12-10-22-17(26)13-29-19-24-23-18(25(19)21)16-5-4-11-28-16/h4-9,11H,10,12-13,21H2,1-3H3,(H,22,26) |
| InChIKey | CAXULTZKBBGIGU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|