C19H21N5O4S — CID 31027284
2-[3-(furan-2-yl)-5-[2-[2-(3-methylphenoxy)ethylamino]-2-oxoethyl]sulfanyl-1,2,4-triazol-4-yl]acetamide (PubChem CID 31027284) has the molecular formula C19H21N5O4S and a molecular weight of 415.48 g/mol. Its IUPAC name is 2-[3-(furan-2-yl)-5-[2-[2-(3-methylphenoxy)ethylamino]-2-oxoethyl]sulfanyl-1,2,4-triazol-4-yl]acetamide.
| Compound Name | 2-[3-(furan-2-yl)-5-[2-[2-(3-methylphenoxy)ethylamino]-2-oxoethyl]sulfanyl-1,2,4-triazol-4-yl]acetamide |
|---|---|
| PubChem CID | 31027284 |
| Molecular Formula | C19H21N5O4S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 2-[3-(furan-2-yl)-5-[2-[2-(3-methylphenoxy)ethylamino]-2-oxoethyl]sulfanyl-1,2,4-triazol-4-yl]acetamide |
| SMILES | Cc1cccc(OCCNC(=O)CSc2nnc(-c3ccco3)n2CC(N)=O)c1 |
| InChI | InChI=1S/C19H21N5O4S/c1-13-4-2-5-14(10-13)27-9-7-21-17(26)12-29-19-23-22-18(15-6-3-8-28-15)24(19)11-16(20)25/h2-6,8,10H,7,9,11-12H2,1H3,(H2,20,25)(H,21,26) |
| InChIKey | BDLRLPMAKOUISF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 125.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|