C17H17ClN4O3S — CID 9343145
N-[2-(4-chlorophenoxy)ethyl]-2-[[5-(furan-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 9343145) has the molecular formula C17H17ClN4O3S and a molecular weight of 392.87 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)ethyl]-2-[[5-(furan-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[2-(4-chlorophenoxy)ethyl]-2-[[5-(furan-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 9343145 |
| Molecular Formula | C17H17ClN4O3S |
| Molecular Weight | 392.87 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | N-[2-(4-chlorophenoxy)ethyl]-2-[[5-(furan-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cn1c(SCC(=O)NCCOc2ccc(Cl)cc2)nnc1-c1ccco1 |
| InChI | InChI=1S/C17H17ClN4O3S/c1-22-16(14-3-2-9-25-14)20-21-17(22)26-11-15(23)19-8-10-24-13-6-4-12(18)5-7-13/h2-7,9H,8,10-11H2,1H3,(H,19,23) |
| InChIKey | HQIYCNOHVSZCKK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.87 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|