C15H14ClN3O2S — CID 7311197
3-[2-(4-chlorophenoxy)ethylsulfanyl]-5-(furan-2-yl)-4-methyl-1,2,4-triazole (PubChem CID 7311197) has the molecular formula C15H14ClN3O2S and a molecular weight of 335.82 g/mol. Its IUPAC name is 3-[2-(4-chlorophenoxy)ethylsulfanyl]-5-(furan-2-yl)-4-methyl-1,2,4-triazole.
| Compound Name | 3-[2-(4-chlorophenoxy)ethylsulfanyl]-5-(furan-2-yl)-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 7311197 |
| Molecular Formula | C15H14ClN3O2S |
| Molecular Weight | 335.82 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 3-[2-(4-chlorophenoxy)ethylsulfanyl]-5-(furan-2-yl)-4-methyl-1,2,4-triazole |
| SMILES | Cn1c(SCCOc2ccc(Cl)cc2)nnc1-c1ccco1 |
| InChI | InChI=1S/C15H14ClN3O2S/c1-19-14(13-3-2-8-21-13)17-18-15(19)22-10-9-20-12-6-4-11(16)5-7-12/h2-8H,9-10H2,1H3 |
| InChIKey | LXGDUCIVTHQYLX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 53.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.82 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|