C14H12Cl2N4O2S — CID 7273058
3-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-5-(furan-2-yl)-1,2,4-triazol-4-amine (PubChem CID 7273058) has the molecular formula C14H12Cl2N4O2S and a molecular weight of 371.25 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-5-(furan-2-yl)-1,2,4-triazol-4-amine.
| Compound Name | 3-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-5-(furan-2-yl)-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 7273058 |
| Molecular Formula | C14H12Cl2N4O2S |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | 3-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-5-(furan-2-yl)-1,2,4-triazol-4-amine |
| SMILES | Nn1c(SCCOc2ccc(Cl)cc2Cl)nnc1-c1ccco1 |
| InChI | InChI=1S/C14H12Cl2N4O2S/c15-9-3-4-11(10(16)8-9)22-6-7-23-14-19-18-13(20(14)17)12-2-1-5-21-12/h1-5,8H,6-7,17H2 |
| InChIKey | VPGMQRYEUIPXNF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|