C13H16Cl2N4OS — CID 65294256
2-[3-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]ethanamine (PubChem CID 65294256) has the molecular formula C13H16Cl2N4OS and a molecular weight of 347.27 g/mol. Its IUPAC name is 2-[3-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]ethanamine.
| Compound Name | 2-[3-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 65294256 |
| Molecular Formula | C13H16Cl2N4OS |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 2-[3-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]ethanamine |
| SMILES | Cc1nnc(SCCOc2ccc(Cl)cc2Cl)n1CCN |
| InChI | InChI=1S/C13H16Cl2N4OS/c1-9-17-18-13(19(9)5-4-16)21-7-6-20-12-3-2-10(14)8-11(12)15/h2-3,8H,4-7,16H2,1H3 |
| InChIKey | LSABXDLLNUVYKG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|