C20H21Cl2N3O2S — CID 2414671
3-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-5-(4-methoxyphenyl)-4-propan-2-yl-1,2,4-triazole (PubChem CID 2414671) has the molecular formula C20H21Cl2N3O2S and a molecular weight of 438.38 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-5-(4-methoxyphenyl)-4-propan-2-yl-1,2,4-triazole.
| Compound Name | 3-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-5-(4-methoxyphenyl)-4-propan-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 2414671 |
| Molecular Formula | C20H21Cl2N3O2S |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | 3-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-5-(4-methoxyphenyl)-4-propan-2-yl-1,2,4-triazole |
| SMILES | COc1ccc(-c2nnc(SCCOc3ccc(Cl)cc3Cl)n2C(C)C)cc1 |
| InChI | InChI=1S/C20H21Cl2N3O2S/c1-13(2)25-19(14-4-7-16(26-3)8-5-14)23-24-20(25)28-11-10-27-18-9-6-15(21)12-17(18)22/h4-9,12-13H,10-11H2,1-3H3 |
| InChIKey | PSGBWGREDQXTSY-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|