C17H15Cl2N3OS — CID 7225358
2-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-4-phenylimidazol-1-amine (PubChem CID 7225358) has the molecular formula C17H15Cl2N3OS and a molecular weight of 380.30 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-4-phenylimidazol-1-amine.
| Compound Name | 2-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-4-phenylimidazol-1-amine |
|---|---|
| PubChem CID | 7225358 |
| Molecular Formula | C17H15Cl2N3OS |
| Molecular Weight | 380.30 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | 2-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-4-phenylimidazol-1-amine |
| SMILES | Nn1cc(-c2ccccc2)nc1SCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H15Cl2N3OS/c18-13-6-7-16(14(19)10-13)23-8-9-24-17-21-15(11-22(17)20)12-4-2-1-3-5-12/h1-7,10-11H,8-9,20H2 |
| InChIKey | BOVIWEZJIMDAJE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.30 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|