C10H9Cl2N3OS — CID 7784934
5-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-1H-1,2,4-triazole (PubChem CID 7784934) has the molecular formula C10H9Cl2N3OS and a molecular weight of 290.18 g/mol. Its IUPAC name is 5-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-1H-1,2,4-triazole.
| Compound Name | 5-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 7784934 |
| Molecular Formula | C10H9Cl2N3OS |
| Molecular Weight | 290.18 g/mol |
| Exact Mass | 288.98 |
| IUPAC Name | 5-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-1H-1,2,4-triazole |
| SMILES | Clc1ccc(OCCSc2ncn[nH]2)c(Cl)c1 |
| InChI | InChI=1S/C10H9Cl2N3OS/c11-7-1-2-9(8(12)5-7)16-3-4-17-10-13-6-14-15-10/h1-2,5-6H,3-4H2,(H,13,14,15) |
| InChIKey | VMNIIJOIFPZWEE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.18 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|