C12H15Cl2NOS — CID 66289058
3-[2-(2,4-dichlorophenoxy)ethylsulfanylmethyl]azetidine (PubChem CID 66289058) has the molecular formula C12H15Cl2NOS and a molecular weight of 292.23 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorophenoxy)ethylsulfanylmethyl]azetidine.
| Compound Name | 3-[2-(2,4-dichlorophenoxy)ethylsulfanylmethyl]azetidine |
|---|---|
| PubChem CID | 66289058 |
| Molecular Formula | C12H15Cl2NOS |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 3-[2-(2,4-dichlorophenoxy)ethylsulfanylmethyl]azetidine |
| SMILES | Clc1ccc(OCCSCC2CNC2)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2NOS/c13-10-1-2-12(11(14)5-10)16-3-4-17-8-9-6-15-7-9/h1-2,5,9,15H,3-4,6-8H2 |
| InChIKey | NTVBQBOMPMUBNY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|